About 1-[(1S,2R)-1-(3,4-dichlorophenyl)-2-phenylcyclopropyl]-N-methylmethanamine;hydrochloride
1-[(1S,2R)-1-(3,4-dichlorophenyl)-2-phenylcyclopropyl]-N-methylmethanamine;hydrochloride (PubChem CID 23650493) has the molecular formula C17H18Cl3N
and a molecular weight of 342.70 g/mol. Its IUPAC name is 1-[(1S,2R)-1-(3,4-dichlorophenyl)-2-phenylcyclopropyl]-N-methylmethanamine;hydrochloride.
Molecular Properties
| Compound Name | 1-[(1S,2R)-1-(3,4-dichlorophenyl)-2-phenylcyclopropyl]-N-methylmethanamine;hydrochloride |
| PubChem CID | 23650493 |
| Molecular Formula | C17H18Cl3N |
| Molecular Weight | 342.70 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 1-[(1S,2R)-1-(3,4-dichlorophenyl)-2-phenylcyclopropyl]-N-methylmethanamine;hydrochloride |
| SMILES | CNC[C@@]1(c2ccc(Cl)c(Cl)c2)C[C@@H]1c1ccccc1.Cl |
| InChI | InChI=1S/C17H17Cl2N.ClH/c1-20-11-17(13-7-8-15(18)16(19)9-13)10-14(17)12-5-3-2-4-6-12;/h2-9,14,20H,10-11H2,1H3;1H/t14-,17-;/m1./s1 |
| InChIKey | ZMAXPWJIBWZIGD-SATBOSKTSA-N |
| XLogP | 5.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.70 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[(1S,2R)-1-(3,4-dichlorophenyl)-2-phenylcyclopropyl]-N-methylmethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1S,2R)-1-(3,4-dichlorophenyl)-2-phenylcyclopropyl]-N-methylmethanamine;hydrochloride?
The IUPAC name of 1-[(1S,2R)-1-(3,4-dichlorophenyl)-2-phenylcyclopropyl]-N-methylmethanamine;hydrochloride (CID 23650493) is 1-[(1S,2R)-1-(3,4-dichlorophenyl)-2-phenylcyclopropyl]-N-methylmethanamine;hydrochloride.
What is the SMILES notation for 1-[(1S,2R)-1-(3,4-dichlorophenyl)-2-phenylcyclopropyl]-N-methylmethanamine;hydrochloride?
The canonical SMILES for 1-[(1S,2R)-1-(3,4-dichlorophenyl)-2-phenylcyclopropyl]-N-methylmethanamine;hydrochloride is CNC[C@@]1(c2ccc(Cl)c(Cl)c2)C[C@@H]1c1ccccc1.Cl.
What is the InChIKey of 1-[(1S,2R)-1-(3,4-dichlorophenyl)-2-phenylcyclopropyl]-N-methylmethanamine;hydrochloride?
The InChIKey is ZMAXPWJIBWZIGD-SATBOSKTSA-N. The full InChI is InChI=1S/C17H17Cl2N.ClH/c1-20-11-17(13-7-8-15(18)16(19)9-13)10-14(17)12-5-3-2-4-6-12;/h2-9,14,20H,10-11H2,1H3;1H/t14-,17-;/m1./s1.
What are the key properties of 1-[(1S,2R)-1-(3,4-dichlorophenyl)-2-phenylcyclopropyl]-N-methylmethanamine;hydrochloride?
1-[(1S,2R)-1-(3,4-dichlorophenyl)-2-phenylcyclopropyl]-N-methylmethanamine;hydrochloride has a molecular weight of 342.70 g/mol, XLogP of 5.06, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1S,2R)-1-(3,4-dichlorophenyl)-2-phenylcyclopropyl]-N-methylmethanamine;hydrochloride is sourced from PubChem (CID 23650493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).