C16H23FO7 — CID 23650739
ethyl (Z)-2-fluoro-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]prop-2-enoate (PubChem CID 23650739) has the molecular formula C16H23FO7 and a molecular weight of 346.35 g/mol. Its IUPAC name is ethyl (Z)-2-fluoro-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]prop-2-enoate.
| Compound Name | ethyl (Z)-2-fluoro-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]prop-2-enoate |
|---|---|
| PubChem CID | 23650739 |
| Molecular Formula | C16H23FO7 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | ethyl (Z)-2-fluoro-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C(F)=C/[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C16H23FO7/c1-6-19-13(18)8(17)7-9-10-11(22-15(2,3)21-10)12-14(20-9)24-16(4,5)23-12/h7,9-12,14H,6H2,1-5H3/b8-7-/t9-,10+,11+,12-,14-/m1/s1 |
| InChIKey | JVXHWXKHZGZXSO-SOSYAZATSA-N |
| XLogP | 1.80 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|