C24H28F2N2O4 — CID 23651151
3-[[2-[5-[[4-(1,1-difluoro-2-methylpropyl)phenyl]methoxy]-2,3-dihydroindol-1-yl]-2-oxoethyl]amino]propanoic acid (PubChem CID 23651151) has the molecular formula C24H28F2N2O4 and a molecular weight of 446.49 g/mol. Its IUPAC name is 3-[[2-[5-[[4-(1,1-difluoro-2-methylpropyl)phenyl]methoxy]-2,3-dihydroindol-1-yl]-2-oxoethyl]amino]propanoic acid.
| Compound Name | 3-[[2-[5-[[4-(1,1-difluoro-2-methylpropyl)phenyl]methoxy]-2,3-dihydroindol-1-yl]-2-oxoethyl]amino]propanoic acid |
|---|---|
| PubChem CID | 23651151 |
| Molecular Formula | C24H28F2N2O4 |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 3-[[2-[5-[[4-(1,1-difluoro-2-methylpropyl)phenyl]methoxy]-2,3-dihydroindol-1-yl]-2-oxoethyl]amino]propanoic acid |
| SMILES | CC(C)C(F)(F)c1ccc(COc2ccc3c(c2)CCN3C(=O)CNCCC(=O)O)cc1 |
| InChI | InChI=1S/C24H28F2N2O4/c1-16(2)24(25,26)19-5-3-17(4-6-19)15-32-20-7-8-21-18(13-20)10-12-28(21)22(29)14-27-11-9-23(30)31/h3-8,13,16,27H,9-12,14-15H2,1-2H3,(H,30,31) |
| InChIKey | QNZYKKWBCUSKIN-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|