C11H16O2 — CID 23651205
(1S,4R,8S)-8-(2-hydroxyethyl)-5-methylbicyclo[2.2.2]oct-5-en-2-one (PubChem CID 23651205) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is (1S,4R,8S)-8-(2-hydroxyethyl)-5-methylbicyclo[2.2.2]oct-5-en-2-one.
| Compound Name | (1S,4R,8S)-8-(2-hydroxyethyl)-5-methylbicyclo[2.2.2]oct-5-en-2-one |
|---|---|
| PubChem CID | 23651205 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | (1S,4R,8S)-8-(2-hydroxyethyl)-5-methylbicyclo[2.2.2]oct-5-en-2-one |
| SMILES | CC1=C[C@@H]2C[C@@H](CCO)[C@H]1CC2=O |
| InChI | InChI=1S/C11H16O2/c1-7-4-9-5-8(2-3-12)10(7)6-11(9)13/h4,8-10,12H,2-3,5-6H2,1H3/t8-,9-,10+/m1/s1 |
| InChIKey | HQOPNBZJKVCBIU-BBBLOLIVSA-N |
| XLogP | 1.54 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|