C16H16O2 — CID 23651347
(1R,3R,6R,7R,10R)-8-methyl-10-phenyl-4-oxatricyclo[4.3.1.03,7]dec-8-en-2-one (PubChem CID 23651347) has the molecular formula C16H16O2 and a molecular weight of 240.30 g/mol. Its IUPAC name is (1R,3R,6R,7R,10R)-8-methyl-10-phenyl-4-oxatricyclo[4.3.1.03,7]dec-8-en-2-one.
| Compound Name | (1R,3R,6R,7R,10R)-8-methyl-10-phenyl-4-oxatricyclo[4.3.1.03,7]dec-8-en-2-one |
|---|---|
| PubChem CID | 23651347 |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | (1R,3R,6R,7R,10R)-8-methyl-10-phenyl-4-oxatricyclo[4.3.1.03,7]dec-8-en-2-one |
| SMILES | CC1=C[C@H]2C(=O)[C@@H]3OC[C@@H]([C@H]13)[C@H]2c1ccccc1 |
| InChI | InChI=1S/C16H16O2/c1-9-7-11-14(10-5-3-2-4-6-10)12-8-18-16(13(9)12)15(11)17/h2-7,11-14,16H,8H2,1H3/t11-,12+,13+,14+,16-/m1/s1 |
| InChIKey | REXUYPHTPCXGOM-XSEXMBABSA-N |
| XLogP | 2.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|