About 3-(dimethylamino)propyl-triphenylphosphanium;bromide;hydrobromide
3-(dimethylamino)propyl-triphenylphosphanium;bromide;hydrobromide (PubChem CID 23651404) has the molecular formula C23H28Br2NP
and a molecular weight of 509.27 g/mol. Its IUPAC name is 3-(dimethylamino)propyl-triphenylphosphanium;bromide;hydrobromide.
Molecular Properties
| Compound Name | 3-(dimethylamino)propyl-triphenylphosphanium;bromide;hydrobromide |
| PubChem CID | 23651404 |
| Molecular Formula | C23H28Br2NP |
| Molecular Weight | 509.27 g/mol |
| Exact Mass | 507.03 |
| IUPAC Name | 3-(dimethylamino)propyl-triphenylphosphanium;bromide;hydrobromide |
| SMILES | Br.CN(C)CCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-] |
| InChI | InChI=1S/C23H27NP.2BrH/c1-24(2)19-12-20-25(21-13-6-3-7-14-21,22-15-8-4-9-16-22)23-17-10-5-11-18-23;;/h3-11,13-18H,12,19-20H2,1-2H3;2*1H/q+1;;/p-1 |
| InChIKey | NEQVFHFOWYYPBS-UHFFFAOYSA-M |
| XLogP | 1.51 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 509.27 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-(dimethylamino)propyl-triphenylphosphanium;bromide;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dimethylamino)propyl-triphenylphosphanium;bromide;hydrobromide?
The IUPAC name of 3-(dimethylamino)propyl-triphenylphosphanium;bromide;hydrobromide (CID 23651404) is 3-(dimethylamino)propyl-triphenylphosphanium;bromide;hydrobromide.
What is the SMILES notation for 3-(dimethylamino)propyl-triphenylphosphanium;bromide;hydrobromide?
The canonical SMILES for 3-(dimethylamino)propyl-triphenylphosphanium;bromide;hydrobromide is Br.CN(C)CCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-].
What is the InChIKey of 3-(dimethylamino)propyl-triphenylphosphanium;bromide;hydrobromide?
The InChIKey is NEQVFHFOWYYPBS-UHFFFAOYSA-M. The full InChI is InChI=1S/C23H27NP.2BrH/c1-24(2)19-12-20-25(21-13-6-3-7-14-21,22-15-8-4-9-16-22)23-17-10-5-11-18-23;;/h3-11,13-18H,12,19-20H2,1-2H3;2*1H/q+1;;/p-1.
What are the key properties of 3-(dimethylamino)propyl-triphenylphosphanium;bromide;hydrobromide?
3-(dimethylamino)propyl-triphenylphosphanium;bromide;hydrobromide has a molecular weight of 509.27 g/mol, XLogP of 1.51, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dimethylamino)propyl-triphenylphosphanium;bromide;hydrobromide is sourced from PubChem (CID 23651404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).