C27H22F17NO2 — CID 23651516
(5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluoro-2-methyldodecan-2-yl) N-naphthalen-2-yl-N-prop-2-enylcarbamate (PubChem CID 23651516) has the molecular formula C27H22F17NO2 and a molecular weight of 715.44 g/mol. Its IUPAC name is (5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluoro-2-methyldodecan-2-yl) N-naphthalen-2-yl-N-prop-2-enylcarbamate.
| Compound Name | (5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluoro-2-methyldodecan-2-yl) N-naphthalen-2-yl-N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 23651516 |
| Molecular Formula | C27H22F17NO2 |
| Molecular Weight | 715.44 g/mol |
| Exact Mass | 715.14 |
| IUPAC Name | (5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluoro-2-methyldodecan-2-yl) N-naphthalen-2-yl-N-prop-2-enylcarbamate |
| SMILES | C=CCN(C(=O)OC(C)(C)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C27H22F17NO2/c1-4-13-45(17-10-9-15-7-5-6-8-16(15)14-17)18(46)47-19(2,3)11-12-20(28,29)21(30,31)22(32,33)23(34,35)24(36,37)25(38,39)26(40,41)27(42,43)44/h4-10,14H,1,11-13H2,2-3H3 |
| InChIKey | XOIGDVLSCKLUNZ-UHFFFAOYSA-N |
| XLogP | 10.54 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.44 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|