C9H16O6 — CID 23651530
1-[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]propan-2-one (PubChem CID 23651530) has the molecular formula C9H16O6 and a molecular weight of 220.22 g/mol. Its IUPAC name is 1-[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]propan-2-one.
| Compound Name | 1-[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]propan-2-one |
|---|---|
| PubChem CID | 23651530 |
| Molecular Formula | C9H16O6 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 1-[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]propan-2-one |
| SMILES | CC(=O)C[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C9H16O6/c1-4(11)2-5-7(12)9(14)8(13)6(3-10)15-5/h5-10,12-14H,2-3H2,1H3/t5-,6+,7-,8-,9+/m0/s1 |
| InChIKey | XMNOVTHWCLGVID-QKAWAISNSA-N |
| XLogP | -2.19 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |