About [2-(3-chloro-4-fluoroanilino)-2-oxoethyl] 2-[2-methyl-4-(4-methylphenyl)-1,3-thiazol-5-yl]acetate
[2-(3-chloro-4-fluoroanilino)-2-oxoethyl] 2-[2-methyl-4-(4-methylphenyl)-1,3-thiazol-5-yl]acetate (PubChem CID 2365191) has the molecular formula C21H18ClFN2O3S
and a molecular weight of 432.90 g/mol. Its IUPAC name is [2-(3-chloro-4-fluoroanilino)-2-oxoethyl] 2-[2-methyl-4-(4-methylphenyl)-1,3-thiazol-5-yl]acetate.
Molecular Properties
| Compound Name | [2-(3-chloro-4-fluoroanilino)-2-oxoethyl] 2-[2-methyl-4-(4-methylphenyl)-1,3-thiazol-5-yl]acetate |
| PubChem CID | 2365191 |
| Molecular Formula | C21H18ClFN2O3S |
| Molecular Weight | 432.90 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | [2-(3-chloro-4-fluoroanilino)-2-oxoethyl] 2-[2-methyl-4-(4-methylphenyl)-1,3-thiazol-5-yl]acetate |
| SMILES | Cc1ccc(-c2nc(C)sc2CC(=O)OCC(=O)Nc2ccc(F)c(Cl)c2)cc1 |
| InChI | InChI=1S/C21H18ClFN2O3S/c1-12-3-5-14(6-4-12)21-18(29-13(2)24-21)10-20(27)28-11-19(26)25-15-7-8-17(23)16(22)9-15/h3-9H,10-11H2,1-2H3,(H,25,26) |
| InChIKey | ABRVTTYHYYPKIL-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.90 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(3-chloro-4-fluoroanilino)-2-oxoethyl] 2-[2-methyl-4-(4-methylphenyl)-1,3-thiazol-5-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3-chloro-4-fluoroanilino)-2-oxoethyl] 2-[2-methyl-4-(4-methylphenyl)-1,3-thiazol-5-yl]acetate?
The IUPAC name of [2-(3-chloro-4-fluoroanilino)-2-oxoethyl] 2-[2-methyl-4-(4-methylphenyl)-1,3-thiazol-5-yl]acetate (CID 2365191) is [2-(3-chloro-4-fluoroanilino)-2-oxoethyl] 2-[2-methyl-4-(4-methylphenyl)-1,3-thiazol-5-yl]acetate.
What is the SMILES notation for [2-(3-chloro-4-fluoroanilino)-2-oxoethyl] 2-[2-methyl-4-(4-methylphenyl)-1,3-thiazol-5-yl]acetate?
The canonical SMILES for [2-(3-chloro-4-fluoroanilino)-2-oxoethyl] 2-[2-methyl-4-(4-methylphenyl)-1,3-thiazol-5-yl]acetate is Cc1ccc(-c2nc(C)sc2CC(=O)OCC(=O)Nc2ccc(F)c(Cl)c2)cc1.
What is the InChIKey of [2-(3-chloro-4-fluoroanilino)-2-oxoethyl] 2-[2-methyl-4-(4-methylphenyl)-1,3-thiazol-5-yl]acetate?
The InChIKey is ABRVTTYHYYPKIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18ClFN2O3S/c1-12-3-5-14(6-4-12)21-18(29-13(2)24-21)10-20(27)28-11-19(26)25-15-7-8-17(23)16(22)9-15/h3-9H,10-11H2,1-2H3,(H,25,26).
What are the key properties of [2-(3-chloro-4-fluoroanilino)-2-oxoethyl] 2-[2-methyl-4-(4-methylphenyl)-1,3-thiazol-5-yl]acetate?
[2-(3-chloro-4-fluoroanilino)-2-oxoethyl] 2-[2-methyl-4-(4-methylphenyl)-1,3-thiazol-5-yl]acetate has a molecular weight of 432.90 g/mol, XLogP of 4.94, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3-chloro-4-fluoroanilino)-2-oxoethyl] 2-[2-methyl-4-(4-methylphenyl)-1,3-thiazol-5-yl]acetate is sourced from PubChem (CID 2365191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).