C14H22N4O — CID 23651922
6-phenyl-2,4-di(propan-2-yl)-1,2,4,5-tetrazinan-3-one (PubChem CID 23651922) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is 6-phenyl-2,4-di(propan-2-yl)-1,2,4,5-tetrazinan-3-one.
| Compound Name | 6-phenyl-2,4-di(propan-2-yl)-1,2,4,5-tetrazinan-3-one |
|---|---|
| PubChem CID | 23651922 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 6-phenyl-2,4-di(propan-2-yl)-1,2,4,5-tetrazinan-3-one |
| SMILES | CC(C)N1NC(c2ccccc2)NN(C(C)C)C1=O |
| InChI | InChI=1S/C14H22N4O/c1-10(2)17-14(19)18(11(3)4)16-13(15-17)12-8-6-5-7-9-12/h5-11,13,15-16H,1-4H3 |
| InChIKey | WOCGCGMRXGHGOG-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |