C24H24O2 — CID 23652357
(1S,2R,3R,12S,14R,15S)-7,10,17,20-tetramethyl-13,22-dioxahexacyclo[13.6.1.02,14.03,12.06,11.016,21]docosa-4,6,8,10,16,18,20-heptaene (PubChem CID 23652357) has the molecular formula C24H24O2 and a molecular weight of 344.45 g/mol. Its IUPAC name is (1S,2R,3R,12S,14R,15S)-7,10,17,20-tetramethyl-13,22-dioxahexacyclo[13.6.1.02,14.03,12.06,11.016,21]docosa-4,6,8,10,16,18,20-heptaene.
| Compound Name | (1S,2R,3R,12S,14R,15S)-7,10,17,20-tetramethyl-13,22-dioxahexacyclo[13.6.1.02,14.03,12.06,11.016,21]docosa-4,6,8,10,16,18,20-heptaene |
|---|---|
| PubChem CID | 23652357 |
| Molecular Formula | C24H24O2 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | (1S,2R,3R,12S,14R,15S)-7,10,17,20-tetramethyl-13,22-dioxahexacyclo[13.6.1.02,14.03,12.06,11.016,21]docosa-4,6,8,10,16,18,20-heptaene |
| SMILES | Cc1ccc(C)c2c1C=C[C@@H]1[C@H]3[C@@H](O[C@H]21)[C@H]1O[C@@H]3c2c(C)ccc(C)c21 |
| InChI | InChI=1S/C24H24O2/c1-11-5-6-12(2)17-15(11)9-10-16-20-22-18-13(3)7-8-14(4)19(18)23(26-22)24(20)25-21(16)17/h5-10,16,20-24H,1-4H3/t16-,20-,21+,22-,23+,24-/m1/s1 |
| InChIKey | WSUUGOPKLOBFDO-QMXNGUBASA-N |
| XLogP | 5.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |