C28H23FN4O5S — CID 23652481
benzenesulfonic acid;1-(2-fluorophenyl)-3-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)urea (PubChem CID 23652481) has the molecular formula C28H23FN4O5S and a molecular weight of 546.58 g/mol. Its IUPAC name is benzenesulfonic acid;1-(2-fluorophenyl)-3-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)urea.
| Compound Name | benzenesulfonic acid;1-(2-fluorophenyl)-3-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)urea |
|---|---|
| PubChem CID | 23652481 |
| Molecular Formula | C28H23FN4O5S |
| Molecular Weight | 546.58 g/mol |
| Exact Mass | 546.14 |
| IUPAC Name | benzenesulfonic acid;1-(2-fluorophenyl)-3-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)urea |
| SMILES | O=C(Nc1ccccc1F)NC1N=C(c2ccccc2)c2ccccc2NC1=O.O=S(=O)(O)c1ccccc1 |
| InChI | InChI=1S/C22H17FN4O2.C6H6O3S/c23-16-11-5-7-13-18(16)25-22(29)27-20-21(28)24-17-12-6-4-10-15(17)19(26-20)14-8-2-1-3-9-14;7-10(8,9)6-4-2-1-3-5-6/h1-13,20H,(H,24,28)(H2,25,27,29);1-5H,(H,7,8,9) |
| InChIKey | GPMMHUHNHFLUPP-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 136.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.58 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|