C29H27F3N6O3 — CID 23652572
6-(6-acetamidopyrimidin-4-yl)oxy-N-[4-(3-aminopiperidin-1-yl)-3-(trifluoromethyl)phenyl]naphthalene-1-carboxamide (PubChem CID 23652572) has the molecular formula C29H27F3N6O3 and a molecular weight of 564.57 g/mol. Its IUPAC name is 6-(6-acetamidopyrimidin-4-yl)oxy-N-[4-(3-aminopiperidin-1-yl)-3-(trifluoromethyl)phenyl]naphthalene-1-carboxamide.
| Compound Name | 6-(6-acetamidopyrimidin-4-yl)oxy-N-[4-(3-aminopiperidin-1-yl)-3-(trifluoromethyl)phenyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 23652572 |
| Molecular Formula | C29H27F3N6O3 |
| Molecular Weight | 564.57 g/mol |
| Exact Mass | 564.21 |
| IUPAC Name | 6-(6-acetamidopyrimidin-4-yl)oxy-N-[4-(3-aminopiperidin-1-yl)-3-(trifluoromethyl)phenyl]naphthalene-1-carboxamide |
| SMILES | CC(=O)Nc1cc(Oc2ccc3c(C(=O)Nc4ccc(N5CCCC(N)C5)c(C(F)(F)F)c4)cccc3c2)ncn1 |
| InChI | InChI=1S/C29H27F3N6O3/c1-17(39)36-26-14-27(35-16-34-26)41-21-8-9-22-18(12-21)4-2-6-23(22)28(40)37-20-7-10-25(24(13-20)29(30,31)32)38-11-3-5-19(33)15-38/h2,4,6-10,12-14,16,19H,3,5,11,15,33H2,1H3,(H,37,40)(H,34,35,36,39) |
| InChIKey | ZPXVABKWYWCMSV-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 122.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.57 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|