C17H15N3O3S3 — CID 2365274
N-[[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]thiophene-2-carboxamide (PubChem CID 2365274) has the molecular formula C17H15N3O3S3 and a molecular weight of 405.53 g/mol. Its IUPAC name is N-[[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]thiophene-2-carboxamide.
| Compound Name | N-[[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 2365274 |
| Molecular Formula | C17H15N3O3S3 |
| Molecular Weight | 405.53 g/mol |
| Exact Mass | 405.03 |
| IUPAC Name | N-[[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]thiophene-2-carboxamide |
| SMILES | COc1ccc(-c2csc(NC(=S)NC(=O)c3cccs3)n2)cc1OC |
| InChI | InChI=1S/C17H15N3O3S3/c1-22-12-6-5-10(8-13(12)23-2)11-9-26-17(18-11)20-16(24)19-15(21)14-4-3-7-25-14/h3-9H,1-2H3,(H2,18,19,20,21,24) |
| InChIKey | HFIPUNBOEBEEST-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.53 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|