About N-[4-(2-fluoroethylamino)-5-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl]acetamide
N-[4-(2-fluoroethylamino)-5-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl]acetamide (PubChem CID 23652841) has the molecular formula C11H13FN2O3
and a molecular weight of 240.23 g/mol. Its IUPAC name is N-[4-(2-fluoroethylamino)-5-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl]acetamide.
Molecular Properties
| Compound Name | N-[4-(2-fluoroethylamino)-5-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl]acetamide |
| PubChem CID | 23652841 |
| Molecular Formula | C11H13FN2O3 |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | N-[4-(2-fluoroethylamino)-5-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl]acetamide |
| SMILES | CC(=O)NC1=CC(=O)C(NCCF)=C(C)C1=O |
| InChI | InChI=1S/C11H13FN2O3/c1-6-10(13-4-3-12)9(16)5-8(11(6)17)14-7(2)15/h5,13H,3-4H2,1-2H3,(H,14,15) |
| InChIKey | CKDYPQBSYOGWCO-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(2-fluoroethylamino)-5-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(2-fluoroethylamino)-5-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl]acetamide?
The IUPAC name of N-[4-(2-fluoroethylamino)-5-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl]acetamide (CID 23652841) is N-[4-(2-fluoroethylamino)-5-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl]acetamide.
What is the SMILES notation for N-[4-(2-fluoroethylamino)-5-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl]acetamide?
The canonical SMILES for N-[4-(2-fluoroethylamino)-5-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl]acetamide is CC(=O)NC1=CC(=O)C(NCCF)=C(C)C1=O.
What is the InChIKey of N-[4-(2-fluoroethylamino)-5-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl]acetamide?
The InChIKey is CKDYPQBSYOGWCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13FN2O3/c1-6-10(13-4-3-12)9(16)5-8(11(6)17)14-7(2)15/h5,13H,3-4H2,1-2H3,(H,14,15).
What are the key properties of N-[4-(2-fluoroethylamino)-5-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl]acetamide?
N-[4-(2-fluoroethylamino)-5-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl]acetamide has a molecular weight of 240.23 g/mol, XLogP of -0.01, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(2-fluoroethylamino)-5-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl]acetamide is sourced from PubChem (CID 23652841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).