C18H17Cl2N5O6 — CID 23652875
[2-(4-amino-2,6-dichloroanilino)-4,5-dihydroimidazol-1-yl]methyl [4-(nitrooxymethyl)phenyl] carbonate (PubChem CID 23652875) has the molecular formula C18H17Cl2N5O6 and a molecular weight of 470.27 g/mol. Its IUPAC name is [2-(4-amino-2,6-dichloroanilino)-4,5-dihydroimidazol-1-yl]methyl [4-(nitrooxymethyl)phenyl] carbonate.
| Compound Name | [2-(4-amino-2,6-dichloroanilino)-4,5-dihydroimidazol-1-yl]methyl [4-(nitrooxymethyl)phenyl] carbonate |
|---|---|
| PubChem CID | 23652875 |
| Molecular Formula | C18H17Cl2N5O6 |
| Molecular Weight | 470.27 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | [2-(4-amino-2,6-dichloroanilino)-4,5-dihydroimidazol-1-yl]methyl [4-(nitrooxymethyl)phenyl] carbonate |
| SMILES | Nc1cc(Cl)c(NC2=NCCN2COC(=O)Oc2ccc(CO[N+](=O)[O-])cc2)c(Cl)c1 |
| InChI | InChI=1S/C18H17Cl2N5O6/c19-14-7-12(21)8-15(20)16(14)23-17-22-5-6-24(17)10-29-18(26)31-13-3-1-11(2-4-13)9-30-25(27)28/h1-4,7-8H,5-6,9-10,21H2,(H,22,23) |
| InChIKey | UJPVPKSMZHCNRK-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 141.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.27 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|