About 2-amino-5-iodo-4-(2,2,2-trifluoroethylsulfanyl)benzonitrile
2-amino-5-iodo-4-(2,2,2-trifluoroethylsulfanyl)benzonitrile (PubChem CID 23653075) has the molecular formula C9H6F3IN2S
and a molecular weight of 358.13 g/mol. Its IUPAC name is 2-amino-5-iodo-4-(2,2,2-trifluoroethylsulfanyl)benzonitrile.
Molecular Properties
| Compound Name | 2-amino-5-iodo-4-(2,2,2-trifluoroethylsulfanyl)benzonitrile |
| PubChem CID | 23653075 |
| Molecular Formula | C9H6F3IN2S |
| Molecular Weight | 358.13 g/mol |
| Exact Mass | 357.92 |
| IUPAC Name | 2-amino-5-iodo-4-(2,2,2-trifluoroethylsulfanyl)benzonitrile |
| SMILES | N#Cc1cc(I)c(SCC(F)(F)F)cc1N |
| InChI | InChI=1S/C9H6F3IN2S/c10-9(11,12)4-16-8-2-7(15)5(3-14)1-6(8)13/h1-2H,4,15H2 |
| InChIKey | FOJGACLSTLBKAY-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.13 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-5-iodo-4-(2,2,2-trifluoroethylsulfanyl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-iodo-4-(2,2,2-trifluoroethylsulfanyl)benzonitrile?
The IUPAC name of 2-amino-5-iodo-4-(2,2,2-trifluoroethylsulfanyl)benzonitrile (CID 23653075) is 2-amino-5-iodo-4-(2,2,2-trifluoroethylsulfanyl)benzonitrile.
What is the SMILES notation for 2-amino-5-iodo-4-(2,2,2-trifluoroethylsulfanyl)benzonitrile?
The canonical SMILES for 2-amino-5-iodo-4-(2,2,2-trifluoroethylsulfanyl)benzonitrile is N#Cc1cc(I)c(SCC(F)(F)F)cc1N.
What is the InChIKey of 2-amino-5-iodo-4-(2,2,2-trifluoroethylsulfanyl)benzonitrile?
The InChIKey is FOJGACLSTLBKAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6F3IN2S/c10-9(11,12)4-16-8-2-7(15)5(3-14)1-6(8)13/h1-2H,4,15H2.
What are the key properties of 2-amino-5-iodo-4-(2,2,2-trifluoroethylsulfanyl)benzonitrile?
2-amino-5-iodo-4-(2,2,2-trifluoroethylsulfanyl)benzonitrile has a molecular weight of 358.13 g/mol, XLogP of 3.40, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-iodo-4-(2,2,2-trifluoroethylsulfanyl)benzonitrile is sourced from PubChem (CID 23653075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).