C12H28N2O14P4 — CID 23653098
N,N'-bis(buta-2,3-dienyl)butane-1,4-diamine;bis(phosphono dihydrogen phosphate) (PubChem CID 23653098) has the molecular formula C12H28N2O14P4 and a molecular weight of 548.25 g/mol. Its IUPAC name is N,N'-bis(buta-2,3-dienyl)butane-1,4-diamine;bis(phosphono dihydrogen phosphate).
| Compound Name | N,N'-bis(buta-2,3-dienyl)butane-1,4-diamine;bis(phosphono dihydrogen phosphate) |
|---|---|
| PubChem CID | 23653098 |
| Molecular Formula | C12H28N2O14P4 |
| Molecular Weight | 548.25 g/mol |
| Exact Mass | 548.05 |
| IUPAC Name | N,N'-bis(buta-2,3-dienyl)butane-1,4-diamine;bis(phosphono dihydrogen phosphate) |
| SMILES | C=C=CCNCCCCNCC=C=C.O=P(O)(O)OP(=O)(O)O.O=P(O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C12H20N2.2H4O7P2/c1-3-5-9-13-11-7-8-12-14-10-6-4-2;2*1-8(2,3)7-9(4,5)6/h5-6,13-14H,1-2,7-12H2;2*(H2,1,2,3)(H2,4,5,6) |
| InChIKey | GHZPMIDUFQXHJK-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 272.64 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.25 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|