C24H18Cl3N3O2S — CID 2365311
2-[3-(3,4-dimethylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 2365311) has the molecular formula C24H18Cl3N3O2S and a molecular weight of 518.85 g/mol. Its IUPAC name is 2-[3-(3,4-dimethylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[3-(3,4-dimethylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 2365311 |
| Molecular Formula | C24H18Cl3N3O2S |
| Molecular Weight | 518.85 g/mol |
| Exact Mass | 517.02 |
| IUPAC Name | 2-[3-(3,4-dimethylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | Cc1ccc(-n2c(SCC(=O)Nc3cc(Cl)c(Cl)cc3Cl)nc3ccccc3c2=O)cc1C |
| InChI | InChI=1S/C24H18Cl3N3O2S/c1-13-7-8-15(9-14(13)2)30-23(32)16-5-3-4-6-20(16)29-24(30)33-12-22(31)28-21-11-18(26)17(25)10-19(21)27/h3-11H,12H2,1-2H3,(H,28,31) |
| InChIKey | SUEBVPIFESZEPX-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.85 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|