C21H19N3O2 — CID 23653243
methyl 6-benzyl-8,12-dimethyl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carboxylate (PubChem CID 23653243) has the molecular formula C21H19N3O2 and a molecular weight of 345.40 g/mol. Its IUPAC name is methyl 6-benzyl-8,12-dimethyl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carboxylate.
| Compound Name | methyl 6-benzyl-8,12-dimethyl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carboxylate |
|---|---|
| PubChem CID | 23653243 |
| Molecular Formula | C21H19N3O2 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | methyl 6-benzyl-8,12-dimethyl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene-4-carboxylate |
| SMILES | COC(=O)c1cc2c3cc(C)cnc3n(C)c2c(Cc2ccccc2)n1 |
| InChI | InChI=1S/C21H19N3O2/c1-13-9-16-15-11-18(21(25)26-3)23-17(10-14-7-5-4-6-8-14)19(15)24(2)20(16)22-12-13/h4-9,11-12H,10H2,1-3H3 |
| InChIKey | QRFZNWRSZWLUGH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |