C17H14F2N2OS — CID 2365337
3-(2,4-difluorophenyl)-2-propan-2-ylsulfanylquinazolin-4-one (PubChem CID 2365337) has the molecular formula C17H14F2N2OS and a molecular weight of 332.38 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)-2-propan-2-ylsulfanylquinazolin-4-one.
| Compound Name | 3-(2,4-difluorophenyl)-2-propan-2-ylsulfanylquinazolin-4-one |
|---|---|
| PubChem CID | 2365337 |
| Molecular Formula | C17H14F2N2OS |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 3-(2,4-difluorophenyl)-2-propan-2-ylsulfanylquinazolin-4-one |
| SMILES | CC(C)Sc1nc2ccccc2c(=O)n1-c1ccc(F)cc1F |
| InChI | InChI=1S/C17H14F2N2OS/c1-10(2)23-17-20-14-6-4-3-5-12(14)16(22)21(17)15-8-7-11(18)9-13(15)19/h3-10H,1-2H3 |
| InChIKey | YCKNSNNBRFZBEB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |