C27H27ClN2O2 — CID 23653547
(E)-3-[3-(4-chlorophenoxy)-2,6,6-trimethylcyclohexen-1-yl]-N-isoquinolin-5-ylprop-2-enamide (PubChem CID 23653547) has the molecular formula C27H27ClN2O2 and a molecular weight of 446.98 g/mol. Its IUPAC name is (E)-3-[3-(4-chlorophenoxy)-2,6,6-trimethylcyclohexen-1-yl]-N-isoquinolin-5-ylprop-2-enamide.
| Compound Name | (E)-3-[3-(4-chlorophenoxy)-2,6,6-trimethylcyclohexen-1-yl]-N-isoquinolin-5-ylprop-2-enamide |
|---|---|
| PubChem CID | 23653547 |
| Molecular Formula | C27H27ClN2O2 |
| Molecular Weight | 446.98 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | (E)-3-[3-(4-chlorophenoxy)-2,6,6-trimethylcyclohexen-1-yl]-N-isoquinolin-5-ylprop-2-enamide |
| SMILES | CC1=C(/C=C/C(=O)Nc2cccc3cnccc23)C(C)(C)CCC1Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H27ClN2O2/c1-18-23(27(2,3)15-13-25(18)32-21-9-7-20(28)8-10-21)11-12-26(31)30-24-6-4-5-19-17-29-16-14-22(19)24/h4-12,14,16-17,25H,13,15H2,1-3H3,(H,30,31)/b12-11+ |
| InChIKey | ISCMXLPWQHBMDT-VAWYXSNFSA-N |
| XLogP | 6.97 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.98 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|