C23H28N4O5 — CID 23653758
5-[(Z)-(6-methoxy-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-N-(2-morpholin-4-ylethoxy)-1H-pyrrole-3-carboxamide (PubChem CID 23653758) has the molecular formula C23H28N4O5 and a molecular weight of 440.50 g/mol. Its IUPAC name is 5-[(Z)-(6-methoxy-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-N-(2-morpholin-4-ylethoxy)-1H-pyrrole-3-carboxamide.
| Compound Name | 5-[(Z)-(6-methoxy-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-N-(2-morpholin-4-ylethoxy)-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 23653758 |
| Molecular Formula | C23H28N4O5 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 5-[(Z)-(6-methoxy-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-N-(2-morpholin-4-ylethoxy)-1H-pyrrole-3-carboxamide |
| SMILES | COc1ccc2c(c1)NC(=O)/C2=C\c1[nH]c(C)c(C(=O)NOCCN2CCOCC2)c1C |
| InChI | InChI=1S/C23H28N4O5/c1-14-19(13-18-17-5-4-16(30-3)12-20(17)25-22(18)28)24-15(2)21(14)23(29)26-32-11-8-27-6-9-31-10-7-27/h4-5,12-13,24H,6-11H2,1-3H3,(H,25,28)(H,26,29)/b18-13- |
| InChIKey | YVCGOBVDSRLYEZ-AQTBWJFISA-N |
| XLogP | 2.13 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|