C11H15IN2O — CID 23653810
3-iodo-1,5-dimethyl-6,7,8,9-tetrahydro-5H-pyrido[2,3-d]azepin-2-one (PubChem CID 23653810) has the molecular formula C11H15IN2O and a molecular weight of 318.16 g/mol. Its IUPAC name is 3-iodo-1,5-dimethyl-6,7,8,9-tetrahydro-5H-pyrido[2,3-d]azepin-2-one.
| Compound Name | 3-iodo-1,5-dimethyl-6,7,8,9-tetrahydro-5H-pyrido[2,3-d]azepin-2-one |
|---|---|
| PubChem CID | 23653810 |
| Molecular Formula | C11H15IN2O |
| Molecular Weight | 318.16 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | 3-iodo-1,5-dimethyl-6,7,8,9-tetrahydro-5H-pyrido[2,3-d]azepin-2-one |
| SMILES | CC1CNCCc2c1cc(I)c(=O)n2C |
| InChI | InChI=1S/C11H15IN2O/c1-7-6-13-4-3-10-8(7)5-9(12)11(15)14(10)2/h5,7,13H,3-4,6H2,1-2H3 |
| InChIKey | MQJJZJXCUMILEE-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.16 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|