C27H29N3O6 — CID 23653931
2-[[4-[[6-[4-(2-ethoxyethoxy)-2,6-dimethylphenyl]-2-pyridinyl]methoxy]phenyl]methyl]-1,2,4-oxadiazolidine-3,5-dione (PubChem CID 23653931) has the molecular formula C27H29N3O6 and a molecular weight of 491.54 g/mol. Its IUPAC name is 2-[[4-[[6-[4-(2-ethoxyethoxy)-2,6-dimethylphenyl]-2-pyridinyl]methoxy]phenyl]methyl]-1,2,4-oxadiazolidine-3,5-dione.
| Compound Name | 2-[[4-[[6-[4-(2-ethoxyethoxy)-2,6-dimethylphenyl]-2-pyridinyl]methoxy]phenyl]methyl]-1,2,4-oxadiazolidine-3,5-dione |
|---|---|
| PubChem CID | 23653931 |
| Molecular Formula | C27H29N3O6 |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | 2-[[4-[[6-[4-(2-ethoxyethoxy)-2,6-dimethylphenyl]-2-pyridinyl]methoxy]phenyl]methyl]-1,2,4-oxadiazolidine-3,5-dione |
| SMILES | CCOCCOc1cc(C)c(-c2cccc(COc3ccc(Cn4oc(=O)[nH]c4=O)cc3)n2)c(C)c1 |
| InChI | InChI=1S/C27H29N3O6/c1-4-33-12-13-34-23-14-18(2)25(19(3)15-23)24-7-5-6-21(28-24)17-35-22-10-8-20(9-11-22)16-30-26(31)29-27(32)36-30/h5-11,14-15H,4,12-13,16-17H2,1-3H3,(H,29,31,32) |
| InChIKey | GVJGQCSIDIGOCU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 108.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|