C12H12F3IN2O2 — CID 23654195
3-iodo-5-methyl-7-(2,2,2-trifluoroacetyl)-5,6,8,9-tetrahydro-1H-pyrido[2,3-d]azepin-2-one (PubChem CID 23654195) has the molecular formula C12H12F3IN2O2 and a molecular weight of 400.14 g/mol. Its IUPAC name is 3-iodo-5-methyl-7-(2,2,2-trifluoroacetyl)-5,6,8,9-tetrahydro-1H-pyrido[2,3-d]azepin-2-one.
| Compound Name | 3-iodo-5-methyl-7-(2,2,2-trifluoroacetyl)-5,6,8,9-tetrahydro-1H-pyrido[2,3-d]azepin-2-one |
|---|---|
| PubChem CID | 23654195 |
| Molecular Formula | C12H12F3IN2O2 |
| Molecular Weight | 400.14 g/mol |
| Exact Mass | 399.99 |
| IUPAC Name | 3-iodo-5-methyl-7-(2,2,2-trifluoroacetyl)-5,6,8,9-tetrahydro-1H-pyrido[2,3-d]azepin-2-one |
| SMILES | CC1CN(C(=O)C(F)(F)F)CCc2[nH]c(=O)c(I)cc21 |
| InChI | InChI=1S/C12H12F3IN2O2/c1-6-5-18(11(20)12(13,14)15)3-2-9-7(6)4-8(16)10(19)17-9/h4,6H,2-3,5H2,1H3,(H,17,19) |
| InChIKey | JDIHSLWCYPIVGC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.14 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|