C14H23NO18S2 — CID 23654299
sulfo (2S,3S,4R,5R,6S)-6-[(2R,3R,4R,5R,6S)-5-acetamido-4,6-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-4,5-dihydroxy-3-sulfooxyoxane-2-carboxylate (PubChem CID 23654299) has the molecular formula C14H23NO18S2 and a molecular weight of 557.46 g/mol. Its IUPAC name is sulfo (2S,3S,4R,5R,6S)-6-[(2R,3R,4R,5R,6S)-5-acetamido-4,6-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-4,5-dihydroxy-3-sulfooxyoxane-2-carboxylate.
| Compound Name | sulfo (2S,3S,4R,5R,6S)-6-[(2R,3R,4R,5R,6S)-5-acetamido-4,6-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-4,5-dihydroxy-3-sulfooxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 23654299 |
| Molecular Formula | C14H23NO18S2 |
| Molecular Weight | 557.46 g/mol |
| Exact Mass | 557.04 |
| IUPAC Name | sulfo (2S,3S,4R,5R,6S)-6-[(2R,3R,4R,5R,6S)-5-acetamido-4,6-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-4,5-dihydroxy-3-sulfooxyoxane-2-carboxylate |
| SMILES | CC(=O)N[C@@H]1[C@@H](O)[C@@H](O[C@H]2O[C@H](C(=O)OS(=O)(=O)O)[C@@H](OS(=O)(=O)O)[C@H](O)[C@H]2O)[C@@H](CO)O[C@@H]1O |
| InChI | InChI=1S/C14H23NO18S2/c1-3(17)15-5-6(18)9(4(2-16)29-12(5)21)30-14-8(20)7(19)10(32-34(23,24)25)11(31-14)13(22)33-35(26,27)28/h4-12,14,16,18-21H,2H2,1H3,(H,15,17)(H,23,24,25)(H,26,27,28)/t4-,5-,6-,7-,8-,9+,10+,11+,12+,14+/m1/s1 |
| InChIKey | KYKLHVAKSBNDQG-DRMAOPEPSA-N |
| XLogP | -6.07 |
| TPSA | 302.21 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.46 |
| LogP ≤ 5 | -6.07 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|