About 4-[4,5-bis(4-methoxyphenyl)-1H-pyrrol-2-yl]-N-hydroxy-N-methylpiperidine-1-carboxamide
4-[4,5-bis(4-methoxyphenyl)-1H-pyrrol-2-yl]-N-hydroxy-N-methylpiperidine-1-carboxamide (PubChem CID 23654560) has the molecular formula C25H29N3O4
and a molecular weight of 435.52 g/mol. Its IUPAC name is 4-[4,5-bis(4-methoxyphenyl)-1H-pyrrol-2-yl]-N-hydroxy-N-methylpiperidine-1-carboxamide.
Molecular Properties
| Compound Name | 4-[4,5-bis(4-methoxyphenyl)-1H-pyrrol-2-yl]-N-hydroxy-N-methylpiperidine-1-carboxamide |
| PubChem CID | 23654560 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | 4-[4,5-bis(4-methoxyphenyl)-1H-pyrrol-2-yl]-N-hydroxy-N-methylpiperidine-1-carboxamide |
| SMILES | COc1ccc(-c2cc(C3CCN(C(=O)N(C)O)CC3)[nH]c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C25H29N3O4/c1-27(30)25(29)28-14-12-18(13-15-28)23-16-22(17-4-8-20(31-2)9-5-17)24(26-23)19-6-10-21(32-3)11-7-19/h4-11,16,18,26,30H,12-15H2,1-3H3 |
| InChIKey | ZYRMDSGWKUZXGZ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 78.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[4,5-bis(4-methoxyphenyl)-1H-pyrrol-2-yl]-N-hydroxy-N-methylpiperidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4,5-bis(4-methoxyphenyl)-1H-pyrrol-2-yl]-N-hydroxy-N-methylpiperidine-1-carboxamide?
The IUPAC name of 4-[4,5-bis(4-methoxyphenyl)-1H-pyrrol-2-yl]-N-hydroxy-N-methylpiperidine-1-carboxamide (CID 23654560) is 4-[4,5-bis(4-methoxyphenyl)-1H-pyrrol-2-yl]-N-hydroxy-N-methylpiperidine-1-carboxamide.
What is the SMILES notation for 4-[4,5-bis(4-methoxyphenyl)-1H-pyrrol-2-yl]-N-hydroxy-N-methylpiperidine-1-carboxamide?
The canonical SMILES for 4-[4,5-bis(4-methoxyphenyl)-1H-pyrrol-2-yl]-N-hydroxy-N-methylpiperidine-1-carboxamide is COc1ccc(-c2cc(C3CCN(C(=O)N(C)O)CC3)[nH]c2-c2ccc(OC)cc2)cc1.
What is the InChIKey of 4-[4,5-bis(4-methoxyphenyl)-1H-pyrrol-2-yl]-N-hydroxy-N-methylpiperidine-1-carboxamide?
The InChIKey is ZYRMDSGWKUZXGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H29N3O4/c1-27(30)25(29)28-14-12-18(13-15-28)23-16-22(17-4-8-20(31-2)9-5-17)24(26-23)19-6-10-21(32-3)11-7-19/h4-11,16,18,26,30H,12-15H2,1-3H3.
What are the key properties of 4-[4,5-bis(4-methoxyphenyl)-1H-pyrrol-2-yl]-N-hydroxy-N-methylpiperidine-1-carboxamide?
4-[4,5-bis(4-methoxyphenyl)-1H-pyrrol-2-yl]-N-hydroxy-N-methylpiperidine-1-carboxamide has a molecular weight of 435.52 g/mol, XLogP of 4.99, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4,5-bis(4-methoxyphenyl)-1H-pyrrol-2-yl]-N-hydroxy-N-methylpiperidine-1-carboxamide is sourced from PubChem (CID 23654560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).