C14H14F3N3O — CID 23654664
2-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[(2,3,4-trifluorophenyl)methyl]acetamide (PubChem CID 23654664) has the molecular formula C14H14F3N3O and a molecular weight of 297.28 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[(2,3,4-trifluorophenyl)methyl]acetamide.
| Compound Name | 2-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[(2,3,4-trifluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 23654664 |
| Molecular Formula | C14H14F3N3O |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 2-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[(2,3,4-trifluorophenyl)methyl]acetamide |
| SMILES | Cc1n[nH]c(C)c1CC(=O)NCc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H14F3N3O/c1-7-10(8(2)20-19-7)5-12(21)18-6-9-3-4-11(15)14(17)13(9)16/h3-4H,5-6H2,1-2H3,(H,18,21)(H,19,20) |
| InChIKey | QFKNCDASCSXLHU-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|