C24H24N3O3+ — CID 23654766
7-[4-hydroxy-4-[(3-phenylphenyl)methyl]piperazin-4-ium-1-yl]-3H-1,3-benzoxazol-2-one (PubChem CID 23654766) has the molecular formula C24H24N3O3+ and a molecular weight of 402.47 g/mol. Its IUPAC name is 7-[4-hydroxy-4-[(3-phenylphenyl)methyl]piperazin-4-ium-1-yl]-3H-1,3-benzoxazol-2-one.
| Compound Name | 7-[4-hydroxy-4-[(3-phenylphenyl)methyl]piperazin-4-ium-1-yl]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 23654766 |
| Molecular Formula | C24H24N3O3+ |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 7-[4-hydroxy-4-[(3-phenylphenyl)methyl]piperazin-4-ium-1-yl]-3H-1,3-benzoxazol-2-one |
| SMILES | O=c1[nH]c2cccc(N3CC[N+](O)(Cc4cccc(-c5ccccc5)c4)CC3)c2o1 |
| InChI | InChI=1S/C24H23N3O3/c28-24-25-21-10-5-11-22(23(21)30-24)26-12-14-27(29,15-13-26)17-18-6-4-9-20(16-18)19-7-2-1-3-8-19/h1-11,16,29H,12-15,17H2/p+1 |
| InChIKey | WUKWDIIKGDQOLR-UHFFFAOYSA-O |
| XLogP | 4.01 |
| TPSA | 69.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|