C23H18FNO5S — CID 23654791
(4-fluorophenyl) 5,6-dioxospiro[3H-benzo[h][1,4]benzoxathiine-2,4'-piperidine]-1'-carboxylate (PubChem CID 23654791) has the molecular formula C23H18FNO5S and a molecular weight of 439.46 g/mol. Its IUPAC name is (4-fluorophenyl) 5,6-dioxospiro[3H-benzo[h][1,4]benzoxathiine-2,4'-piperidine]-1'-carboxylate.
| Compound Name | (4-fluorophenyl) 5,6-dioxospiro[3H-benzo[h][1,4]benzoxathiine-2,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 23654791 |
| Molecular Formula | C23H18FNO5S |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | (4-fluorophenyl) 5,6-dioxospiro[3H-benzo[h][1,4]benzoxathiine-2,4'-piperidine]-1'-carboxylate |
| SMILES | O=C1C(=O)c2ccccc2C2=C1SCC1(CCN(C(=O)Oc3ccc(F)cc3)CC1)O2 |
| InChI | InChI=1S/C23H18FNO5S/c24-14-5-7-15(8-6-14)29-22(28)25-11-9-23(10-12-25)13-31-21-19(27)18(26)16-3-1-2-4-17(16)20(21)30-23/h1-8H,9-13H2 |
| InChIKey | JPQDPGFCWCZTHJ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|