C25H25NO4S — CID 23654871
1'-(3-phenoxypropyl)spiro[3H-benzo[h][1,4]benzoxathiine-2,4'-piperidine]-5,6-dione (PubChem CID 23654871) has the molecular formula C25H25NO4S and a molecular weight of 435.55 g/mol. Its IUPAC name is 1'-(3-phenoxypropyl)spiro[3H-benzo[h][1,4]benzoxathiine-2,4'-piperidine]-5,6-dione.
| Compound Name | 1'-(3-phenoxypropyl)spiro[3H-benzo[h][1,4]benzoxathiine-2,4'-piperidine]-5,6-dione |
|---|---|
| PubChem CID | 23654871 |
| Molecular Formula | C25H25NO4S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 1'-(3-phenoxypropyl)spiro[3H-benzo[h][1,4]benzoxathiine-2,4'-piperidine]-5,6-dione |
| SMILES | O=C1C(=O)c2ccccc2C2=C1SCC1(CCN(CCCOc3ccccc3)CC1)O2 |
| InChI | InChI=1S/C25H25NO4S/c27-21-19-9-4-5-10-20(19)23-24(22(21)28)31-17-25(30-23)11-14-26(15-12-25)13-6-16-29-18-7-2-1-3-8-18/h1-5,7-10H,6,11-17H2 |
| InChIKey | PNCOFXPCFJYVDN-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|