C33H60BrN3O6+2 — CID 23655132
2-[2-(2-bromoethoxy)-5-[(6-ethoxy-6-oxohexyl)carbamoyl]-3-[2-(triethylazaniumyl)ethoxy]phenoxy]ethyl-triethylazanium (PubChem CID 23655132) has the molecular formula C33H60BrN3O6+2 and a molecular weight of 674.76 g/mol. Its IUPAC name is 2-[2-(2-bromoethoxy)-5-[(6-ethoxy-6-oxohexyl)carbamoyl]-3-[2-(triethylazaniumyl)ethoxy]phenoxy]ethyl-triethylazanium.
| Compound Name | 2-[2-(2-bromoethoxy)-5-[(6-ethoxy-6-oxohexyl)carbamoyl]-3-[2-(triethylazaniumyl)ethoxy]phenoxy]ethyl-triethylazanium |
|---|---|
| PubChem CID | 23655132 |
| Molecular Formula | C33H60BrN3O6+2 |
| Molecular Weight | 674.76 g/mol |
| Exact Mass | 673.37 |
| IUPAC Name | 2-[2-(2-bromoethoxy)-5-[(6-ethoxy-6-oxohexyl)carbamoyl]-3-[2-(triethylazaniumyl)ethoxy]phenoxy]ethyl-triethylazanium |
| SMILES | CCOC(=O)CCCCCNC(=O)c1cc(OCC[N+](CC)(CC)CC)c(OCCBr)c(OCC[N+](CC)(CC)CC)c1 |
| InChI | InChI=1S/C33H59BrN3O6/c1-8-36(9-2,10-3)21-24-41-29-26-28(33(39)35-20-17-15-16-18-31(38)40-14-7)27-30(32(29)43-23-19-34)42-25-22-37(11-4,12-5)13-6/h26-27H,8-25H2,1-7H3/q+1/p+1 |
| InChIKey | LVZPJAOCILRVSW-UHFFFAOYSA-O |
| XLogP | 5.82 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.76 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|