C18H17NO3 — CID 2365522
[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl] benzoate (PubChem CID 2365522) has the molecular formula C18H17NO3 and a molecular weight of 295.34 g/mol. Its IUPAC name is [2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl] benzoate.
| Compound Name | [2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl] benzoate |
|---|---|
| PubChem CID | 2365522 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | [2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl] benzoate |
| SMILES | O=C(OCC(=O)N1CCc2ccccc2C1)c1ccccc1 |
| InChI | InChI=1S/C18H17NO3/c20-17(13-22-18(21)15-7-2-1-3-8-15)19-11-10-14-6-4-5-9-16(14)12-19/h1-9H,10-13H2 |
| InChIKey | YYVVXUSBDQZEKY-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |