C18H28O2 — CID 23655270
(10Z,12E,14S)-14-[(Z)-pent-2-enyl]-1-oxacyclotetradeca-10,12-dien-2-one (PubChem CID 23655270) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is (10Z,12E,14S)-14-[(Z)-pent-2-enyl]-1-oxacyclotetradeca-10,12-dien-2-one.
| Compound Name | (10Z,12E,14S)-14-[(Z)-pent-2-enyl]-1-oxacyclotetradeca-10,12-dien-2-one |
|---|---|
| PubChem CID | 23655270 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | (10Z,12E,14S)-14-[(Z)-pent-2-enyl]-1-oxacyclotetradeca-10,12-dien-2-one |
| SMILES | CC/C=C\C[C@H]1/C=C/C=C\CCCCCCCC(=O)O1 |
| InChI | InChI=1S/C18H28O2/c1-2-3-11-14-17-15-12-9-7-5-4-6-8-10-13-16-18(19)20-17/h3,7,9,11-12,15,17H,2,4-6,8,10,13-14,16H2,1H3/b9-7-,11-3-,15-12+/t17-/m0/s1 |
| InChIKey | AEOCGZGNXNIVTO-FQSPHKRJSA-N |
| XLogP | 5.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|