C24H34O6 — CID 23655342
[(1R,4aS,7E,11aR)-4-[1-acetyloxy-2-(3,3-dimethyloxiran-2-yl)ethyl]-7-methyl-11-methylidene-4a,5,6,9,10,11a-hexahydro-1H-cyclonona[c]pyran-1-yl] acetate (PubChem CID 23655342) has the molecular formula C24H34O6 and a molecular weight of 418.53 g/mol. Its IUPAC name is [(1R,4aS,7E,11aR)-4-[1-acetyloxy-2-(3,3-dimethyloxiran-2-yl)ethyl]-7-methyl-11-methylidene-4a,5,6,9,10,11a-hexahydro-1H-cyclonona[c]pyran-1-yl] acetate.
| Compound Name | [(1R,4aS,7E,11aR)-4-[1-acetyloxy-2-(3,3-dimethyloxiran-2-yl)ethyl]-7-methyl-11-methylidene-4a,5,6,9,10,11a-hexahydro-1H-cyclonona[c]pyran-1-yl] acetate |
|---|---|
| PubChem CID | 23655342 |
| Molecular Formula | C24H34O6 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | [(1R,4aS,7E,11aR)-4-[1-acetyloxy-2-(3,3-dimethyloxiran-2-yl)ethyl]-7-methyl-11-methylidene-4a,5,6,9,10,11a-hexahydro-1H-cyclonona[c]pyran-1-yl] acetate |
| SMILES | C=C1CC/C=C(\C)CC[C@@H]2C(C(CC3OC3(C)C)OC(C)=O)=CO[C@H](OC(C)=O)[C@@H]12 |
| InChI | InChI=1S/C24H34O6/c1-14-8-7-9-15(2)22-18(11-10-14)19(13-27-23(22)29-17(4)26)20(28-16(3)25)12-21-24(5,6)30-21/h8,13,18,20-23H,2,7,9-12H2,1,3-6H3/b14-8+/t18-,20?,21?,22+,23-/m1/s1 |
| InChIKey | HYWGXXPXYSEUFQ-OWOWRESQSA-N |
| XLogP | 4.60 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|