C24H38O5 — CID 23655343
[(2E,4E)-2-[(1S,4E,9R)-9-(dimethoxymethyl)-4-methyl-8-methylidenecyclonon-4-en-1-yl]-6-hydroxy-6-methylhepta-2,4-dienyl] acetate (PubChem CID 23655343) has the molecular formula C24H38O5 and a molecular weight of 406.56 g/mol. Its IUPAC name is [(2E,4E)-2-[(1S,4E,9R)-9-(dimethoxymethyl)-4-methyl-8-methylidenecyclonon-4-en-1-yl]-6-hydroxy-6-methylhepta-2,4-dienyl] acetate.
| Compound Name | [(2E,4E)-2-[(1S,4E,9R)-9-(dimethoxymethyl)-4-methyl-8-methylidenecyclonon-4-en-1-yl]-6-hydroxy-6-methylhepta-2,4-dienyl] acetate |
|---|---|
| PubChem CID | 23655343 |
| Molecular Formula | C24H38O5 |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | [(2E,4E)-2-[(1S,4E,9R)-9-(dimethoxymethyl)-4-methyl-8-methylidenecyclonon-4-en-1-yl]-6-hydroxy-6-methylhepta-2,4-dienyl] acetate |
| SMILES | C=C1CC/C=C(\C)CC[C@H](/C(=C\C=C\C(C)(C)O)COC(C)=O)[C@H]1C(OC)OC |
| InChI | InChI=1S/C24H38O5/c1-17-10-8-11-18(2)22(23(27-6)28-7)21(14-13-17)20(16-29-19(3)25)12-9-15-24(4,5)26/h9-10,12,15,21-23,26H,2,8,11,13-14,16H2,1,3-7H3/b15-9+,17-10+,20-12-/t21-,22+/m1/s1 |
| InChIKey | KHKOVGVTSNVTGM-WTGQBYQXSA-N |
| XLogP | 4.73 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|