C23H34O5 — CID 23655344
methyl (1R,2S,5E)-2-[(2Z,4E)-1-acetyloxy-6-hydroxy-6-methylhepta-2,4-dien-2-yl]-5-methyl-9-methylidenecyclonon-5-ene-1-carboxylate (PubChem CID 23655344) has the molecular formula C23H34O5 and a molecular weight of 390.52 g/mol. Its IUPAC name is methyl (1R,2S,5E)-2-[(2Z,4E)-1-acetyloxy-6-hydroxy-6-methylhepta-2,4-dien-2-yl]-5-methyl-9-methylidenecyclonon-5-ene-1-carboxylate.
| Compound Name | methyl (1R,2S,5E)-2-[(2Z,4E)-1-acetyloxy-6-hydroxy-6-methylhepta-2,4-dien-2-yl]-5-methyl-9-methylidenecyclonon-5-ene-1-carboxylate |
|---|---|
| PubChem CID | 23655344 |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | methyl (1R,2S,5E)-2-[(2Z,4E)-1-acetyloxy-6-hydroxy-6-methylhepta-2,4-dien-2-yl]-5-methyl-9-methylidenecyclonon-5-ene-1-carboxylate |
| SMILES | C=C1CC/C=C(\C)CC[C@H](/C(=C/C=C/C(C)(C)O)COC(C)=O)[C@H]1C(=O)OC |
| InChI | InChI=1S/C23H34O5/c1-16-9-7-10-17(2)21(22(25)27-6)20(13-12-16)19(15-28-18(3)24)11-8-14-23(4,5)26/h8-9,11,14,20-21,26H,2,7,10,12-13,15H2,1,3-6H3/b14-8+,16-9+,19-11+/t20-,21+/m1/s1 |
| InChIKey | QAAVINGBTKKGMU-MQQLYBRISA-N |
| XLogP | 4.28 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|