C28H30F3N2O6P — CID 23655473
(2S,3R)-2-amino-1-(1-diphenoxyphosphoryl-1,3-dihydroisoindol-2-yl)-3-methylpentan-1-one;2,2,2-trifluoroacetic acid (PubChem CID 23655473) has the molecular formula C28H30F3N2O6P and a molecular weight of 578.52 g/mol. Its IUPAC name is (2S,3R)-2-amino-1-(1-diphenoxyphosphoryl-1,3-dihydroisoindol-2-yl)-3-methylpentan-1-one;2,2,2-trifluoroacetic acid.
| Compound Name | (2S,3R)-2-amino-1-(1-diphenoxyphosphoryl-1,3-dihydroisoindol-2-yl)-3-methylpentan-1-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 23655473 |
| Molecular Formula | C28H30F3N2O6P |
| Molecular Weight | 578.52 g/mol |
| Exact Mass | 578.18 |
| IUPAC Name | (2S,3R)-2-amino-1-(1-diphenoxyphosphoryl-1,3-dihydroisoindol-2-yl)-3-methylpentan-1-one;2,2,2-trifluoroacetic acid |
| SMILES | CC[C@@H](C)[C@H](N)C(=O)N1Cc2ccccc2C1P(=O)(Oc1ccccc1)Oc1ccccc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H29N2O4P.C2HF3O2/c1-3-19(2)24(27)25(29)28-18-20-12-10-11-17-23(20)26(28)33(30,31-21-13-6-4-7-14-21)32-22-15-8-5-9-16-22;3-2(4,5)1(6)7/h4-17,19,24,26H,3,18,27H2,1-2H3;(H,6,7)/t19-,24+,26?;/m1./s1 |
| InChIKey | ZBETWNCQHWHBQY-UXDDJJJBSA-N |
| XLogP | 6.39 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.52 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|