C22H20N4O5 — CID 23655616
4-(1,3-benzodioxol-5-yl)-3-butyl-2-(4-nitrophenyl)-1,3-oxazolidine-5,5-dicarbonitrile (PubChem CID 23655616) has the molecular formula C22H20N4O5 and a molecular weight of 420.43 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-3-butyl-2-(4-nitrophenyl)-1,3-oxazolidine-5,5-dicarbonitrile.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-3-butyl-2-(4-nitrophenyl)-1,3-oxazolidine-5,5-dicarbonitrile |
|---|---|
| PubChem CID | 23655616 |
| Molecular Formula | C22H20N4O5 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-3-butyl-2-(4-nitrophenyl)-1,3-oxazolidine-5,5-dicarbonitrile |
| SMILES | CCCCN1C(c2ccc([N+](=O)[O-])cc2)OC(C#N)(C#N)C1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H20N4O5/c1-2-3-10-25-20(16-6-9-18-19(11-16)30-14-29-18)22(12-23,13-24)31-21(25)15-4-7-17(8-5-15)26(27)28/h4-9,11,20-21H,2-3,10,14H2,1H3 |
| InChIKey | GCSCFMFNCNBQOA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 121.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|