C18H20FNO4S — CID 23655713
(2R)-2-[benzyl-(4-fluorophenyl)sulfonylamino]-3-methylbutanoic acid (PubChem CID 23655713) has the molecular formula C18H20FNO4S and a molecular weight of 365.43 g/mol. Its IUPAC name is (2R)-2-[benzyl-(4-fluorophenyl)sulfonylamino]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[benzyl-(4-fluorophenyl)sulfonylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 23655713 |
| Molecular Formula | C18H20FNO4S |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | (2R)-2-[benzyl-(4-fluorophenyl)sulfonylamino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](C(=O)O)N(Cc1ccccc1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H20FNO4S/c1-13(2)17(18(21)22)20(12-14-6-4-3-5-7-14)25(23,24)16-10-8-15(19)9-11-16/h3-11,13,17H,12H2,1-2H3,(H,21,22)/t17-/m1/s1 |
| InChIKey | NVEOTSPQRXNTEA-QGZVFWFLSA-N |
| XLogP | 3.13 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |