About methyl 2-[(1,3-dioxoisoindol-2-yl)-(4-nitrophenyl)methyl]prop-2-enoate
methyl 2-[(1,3-dioxoisoindol-2-yl)-(4-nitrophenyl)methyl]prop-2-enoate (PubChem CID 23655864) has the molecular formula C19H14N2O6
and a molecular weight of 366.33 g/mol. Its IUPAC name is methyl 2-[(1,3-dioxoisoindol-2-yl)-(4-nitrophenyl)methyl]prop-2-enoate.
Molecular Properties
| Compound Name | methyl 2-[(1,3-dioxoisoindol-2-yl)-(4-nitrophenyl)methyl]prop-2-enoate |
| PubChem CID | 23655864 |
| Molecular Formula | C19H14N2O6 |
| Molecular Weight | 366.33 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | methyl 2-[(1,3-dioxoisoindol-2-yl)-(4-nitrophenyl)methyl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)C(c1ccc([N+](=O)[O-])cc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H14N2O6/c1-11(19(24)27-2)16(12-7-9-13(10-8-12)21(25)26)20-17(22)14-5-3-4-6-15(14)18(20)23/h3-10,16H,1H2,2H3 |
| InChIKey | FHIWKPWRZWTGLZ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[(1,3-dioxoisoindol-2-yl)-(4-nitrophenyl)methyl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(1,3-dioxoisoindol-2-yl)-(4-nitrophenyl)methyl]prop-2-enoate?
The IUPAC name of methyl 2-[(1,3-dioxoisoindol-2-yl)-(4-nitrophenyl)methyl]prop-2-enoate (CID 23655864) is methyl 2-[(1,3-dioxoisoindol-2-yl)-(4-nitrophenyl)methyl]prop-2-enoate.
What is the SMILES notation for methyl 2-[(1,3-dioxoisoindol-2-yl)-(4-nitrophenyl)methyl]prop-2-enoate?
The canonical SMILES for methyl 2-[(1,3-dioxoisoindol-2-yl)-(4-nitrophenyl)methyl]prop-2-enoate is C=C(C(=O)OC)C(c1ccc([N+](=O)[O-])cc1)N1C(=O)c2ccccc2C1=O.
What is the InChIKey of methyl 2-[(1,3-dioxoisoindol-2-yl)-(4-nitrophenyl)methyl]prop-2-enoate?
The InChIKey is FHIWKPWRZWTGLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14N2O6/c1-11(19(24)27-2)16(12-7-9-13(10-8-12)21(25)26)20-17(22)14-5-3-4-6-15(14)18(20)23/h3-10,16H,1H2,2H3.
What are the key properties of methyl 2-[(1,3-dioxoisoindol-2-yl)-(4-nitrophenyl)methyl]prop-2-enoate?
methyl 2-[(1,3-dioxoisoindol-2-yl)-(4-nitrophenyl)methyl]prop-2-enoate has a molecular weight of 366.33 g/mol, XLogP of 2.66, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(1,3-dioxoisoindol-2-yl)-(4-nitrophenyl)methyl]prop-2-enoate is sourced from PubChem (CID 23655864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).