C11H16O — CID 23655980
(6R)-6-ethyl-4,5-dimethylcyclohexa-1,3-diene-1-carbaldehyde (PubChem CID 23655980) has the molecular formula C11H16O and a molecular weight of 164.25 g/mol. Its IUPAC name is (6R)-6-ethyl-4,5-dimethylcyclohexa-1,3-diene-1-carbaldehyde.
| Compound Name | (6R)-6-ethyl-4,5-dimethylcyclohexa-1,3-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 23655980 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | (6R)-6-ethyl-4,5-dimethylcyclohexa-1,3-diene-1-carbaldehyde |
| SMILES | CC[C@H]1C(C=O)=CC=C(C)C1C |
| InChI | InChI=1S/C11H16O/c1-4-11-9(3)8(2)5-6-10(11)7-12/h5-7,9,11H,4H2,1-3H3/t9?,11-/m1/s1 |
| InChIKey | OZTFPPAOFLMACJ-HCCKASOXSA-N |
| XLogP | 2.73 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|