C25H30N2O5 — CID 23656005
9,11-bis(4-methoxyphenyl)-1,4-dioxa-9,11-diazadispiro[4.1.57.35]pentadecan-13-one (PubChem CID 23656005) has the molecular formula C25H30N2O5 and a molecular weight of 438.52 g/mol. Its IUPAC name is 9,11-bis(4-methoxyphenyl)-1,4-dioxa-9,11-diazadispiro[4.1.57.35]pentadecan-13-one.
| Compound Name | 9,11-bis(4-methoxyphenyl)-1,4-dioxa-9,11-diazadispiro[4.1.57.35]pentadecan-13-one |
|---|---|
| PubChem CID | 23656005 |
| Molecular Formula | C25H30N2O5 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | 9,11-bis(4-methoxyphenyl)-1,4-dioxa-9,11-diazadispiro[4.1.57.35]pentadecan-13-one |
| SMILES | COc1ccc(N2CN(c3ccc(OC)cc3)CC3(C2)CC2(CCC3=O)OCCO2)cc1 |
| InChI | InChI=1S/C25H30N2O5/c1-29-21-7-3-19(4-8-21)26-16-24(15-25(12-11-23(24)28)31-13-14-32-25)17-27(18-26)20-5-9-22(30-2)10-6-20/h3-10H,11-18H2,1-2H3 |
| InChIKey | BEMIZJCDUHIOSY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|