C18H18N4S2 — CID 23656211
N,N'-bis(1,3-benzothiazol-2-yl)-N,N'-dimethylethane-1,2-diamine (PubChem CID 23656211) has the molecular formula C18H18N4S2 and a molecular weight of 354.50 g/mol. Its IUPAC name is N,N'-bis(1,3-benzothiazol-2-yl)-N,N'-dimethylethane-1,2-diamine.
| Compound Name | N,N'-bis(1,3-benzothiazol-2-yl)-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 23656211 |
| Molecular Formula | C18H18N4S2 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | N,N'-bis(1,3-benzothiazol-2-yl)-N,N'-dimethylethane-1,2-diamine |
| SMILES | CN(CCN(C)c1nc2ccccc2s1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C18H18N4S2/c1-21(17-19-13-7-3-5-9-15(13)23-17)11-12-22(2)18-20-14-8-4-6-10-16(14)24-18/h3-10H,11-12H2,1-2H3 |
| InChIKey | LYZBPIIKNUGENU-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |