C24H28N2 — CID 23656445
N-[[4-(anilinomethyl)-2,3,5,6-tetramethylphenyl]methyl]aniline (PubChem CID 23656445) has the molecular formula C24H28N2 and a molecular weight of 344.50 g/mol. Its IUPAC name is N-[[4-(anilinomethyl)-2,3,5,6-tetramethylphenyl]methyl]aniline.
| Compound Name | N-[[4-(anilinomethyl)-2,3,5,6-tetramethylphenyl]methyl]aniline |
|---|---|
| PubChem CID | 23656445 |
| Molecular Formula | C24H28N2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | N-[[4-(anilinomethyl)-2,3,5,6-tetramethylphenyl]methyl]aniline |
| SMILES | Cc1c(C)c(CNc2ccccc2)c(C)c(C)c1CNc1ccccc1 |
| InChI | InChI=1S/C24H28N2/c1-17-18(2)24(16-26-22-13-9-6-10-14-22)20(4)19(3)23(17)15-25-21-11-7-5-8-12-21/h5-14,25-26H,15-16H2,1-4H3 |
| InChIKey | PQFJPYAXFPDZSZ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |