About 2-(benzenesulfonyl)-1-(1,3-thiazol-2-yl)prop-2-en-1-ol
2-(benzenesulfonyl)-1-(1,3-thiazol-2-yl)prop-2-en-1-ol (PubChem CID 23656577) has the molecular formula C12H11NO3S2
and a molecular weight of 281.36 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-1-(1,3-thiazol-2-yl)prop-2-en-1-ol.
Molecular Properties
| Compound Name | 2-(benzenesulfonyl)-1-(1,3-thiazol-2-yl)prop-2-en-1-ol |
| PubChem CID | 23656577 |
| Molecular Formula | C12H11NO3S2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.02 |
| IUPAC Name | 2-(benzenesulfonyl)-1-(1,3-thiazol-2-yl)prop-2-en-1-ol |
| SMILES | C=C(C(O)c1nccs1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H11NO3S2/c1-9(11(14)12-13-7-8-17-12)18(15,16)10-5-3-2-4-6-10/h2-8,11,14H,1H2 |
| InChIKey | GMHGKUHRAWBAMS-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(benzenesulfonyl)-1-(1,3-thiazol-2-yl)prop-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzenesulfonyl)-1-(1,3-thiazol-2-yl)prop-2-en-1-ol?
The IUPAC name of 2-(benzenesulfonyl)-1-(1,3-thiazol-2-yl)prop-2-en-1-ol (CID 23656577) is 2-(benzenesulfonyl)-1-(1,3-thiazol-2-yl)prop-2-en-1-ol.
What is the SMILES notation for 2-(benzenesulfonyl)-1-(1,3-thiazol-2-yl)prop-2-en-1-ol?
The canonical SMILES for 2-(benzenesulfonyl)-1-(1,3-thiazol-2-yl)prop-2-en-1-ol is C=C(C(O)c1nccs1)S(=O)(=O)c1ccccc1.
What is the InChIKey of 2-(benzenesulfonyl)-1-(1,3-thiazol-2-yl)prop-2-en-1-ol?
The InChIKey is GMHGKUHRAWBAMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO3S2/c1-9(11(14)12-13-7-8-17-12)18(15,16)10-5-3-2-4-6-10/h2-8,11,14H,1H2.
What are the key properties of 2-(benzenesulfonyl)-1-(1,3-thiazol-2-yl)prop-2-en-1-ol?
2-(benzenesulfonyl)-1-(1,3-thiazol-2-yl)prop-2-en-1-ol has a molecular weight of 281.36 g/mol, XLogP of 2.16, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzenesulfonyl)-1-(1,3-thiazol-2-yl)prop-2-en-1-ol is sourced from PubChem (CID 23656577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).