About 12-ethoxy-3,8,9-trimethoxy-5-methylbenzo[c]phenanthridin-5-ium-2-ol iodide
12-ethoxy-3,8,9-trimethoxy-5-methylbenzo[c]phenanthridin-5-ium-2-ol iodide (PubChem CID 23656719) has the molecular formula C23H24INO5
and a molecular weight of 521.35 g/mol. Its IUPAC name is 12-ethoxy-3,8,9-trimethoxy-5-methylbenzo[c]phenanthridin-5-ium-2-ol iodide.
Molecular Properties
| Compound Name | 12-ethoxy-3,8,9-trimethoxy-5-methylbenzo[c]phenanthridin-5-ium-2-ol iodide |
| PubChem CID | 23656719 |
| Molecular Formula | C23H24INO5 |
| Molecular Weight | 521.35 g/mol |
| Exact Mass | 521.07 |
| IUPAC Name | 12-ethoxy-3,8,9-trimethoxy-5-methylbenzo[c]phenanthridin-5-ium-2-ol iodide |
| SMILES | CCOc1cc2c3cc(OC)c(OC)cc3c[n+](C)c2c2cc(OC)c(O)cc12.[I-] |
| InChI | InChI=1S/C23H23NO5.HI/c1-6-29-19-10-16-14-9-22(28-5)21(27-4)7-13(14)12-24(2)23(16)17-11-20(26-3)18(25)8-15(17)19;/h7-12H,6H2,1-5H3;1H |
| InChIKey | ZETNANJVAJYZKW-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 521.35 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 12-ethoxy-3,8,9-trimethoxy-5-methylbenzo[c]phenanthridin-5-ium-2-ol iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12-ethoxy-3,8,9-trimethoxy-5-methylbenzo[c]phenanthridin-5-ium-2-ol iodide?
The IUPAC name of 12-ethoxy-3,8,9-trimethoxy-5-methylbenzo[c]phenanthridin-5-ium-2-ol iodide (CID 23656719) is 12-ethoxy-3,8,9-trimethoxy-5-methylbenzo[c]phenanthridin-5-ium-2-ol iodide.
What is the SMILES notation for 12-ethoxy-3,8,9-trimethoxy-5-methylbenzo[c]phenanthridin-5-ium-2-ol iodide?
The canonical SMILES for 12-ethoxy-3,8,9-trimethoxy-5-methylbenzo[c]phenanthridin-5-ium-2-ol iodide is CCOc1cc2c3cc(OC)c(OC)cc3c[n+](C)c2c2cc(OC)c(O)cc12.[I-].
What is the InChIKey of 12-ethoxy-3,8,9-trimethoxy-5-methylbenzo[c]phenanthridin-5-ium-2-ol iodide?
The InChIKey is ZETNANJVAJYZKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23NO5.HI/c1-6-29-19-10-16-14-9-22(28-5)21(27-4)7-13(14)12-24(2)23(16)17-11-20(26-3)18(25)8-15(17)19;/h7-12H,6H2,1-5H3;1H.
What are the key properties of 12-ethoxy-3,8,9-trimethoxy-5-methylbenzo[c]phenanthridin-5-ium-2-ol iodide?
12-ethoxy-3,8,9-trimethoxy-5-methylbenzo[c]phenanthridin-5-ium-2-ol iodide has a molecular weight of 521.35 g/mol, XLogP of 1.10, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 12-ethoxy-3,8,9-trimethoxy-5-methylbenzo[c]phenanthridin-5-ium-2-ol iodide is sourced from PubChem (CID 23656719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).