About 11-phenyl-14,15-dioxadispiro[5.1.58.26]pentadecane
11-phenyl-14,15-dioxadispiro[5.1.58.26]pentadecane (PubChem CID 23656723) has the molecular formula C19H26O2
and a molecular weight of 286.41 g/mol. Its IUPAC name is 11-phenyl-14,15-dioxadispiro[5.1.58.26]pentadecane.
Molecular Properties
| Compound Name | 11-phenyl-14,15-dioxadispiro[5.1.58.26]pentadecane |
| PubChem CID | 23656723 |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | 11-phenyl-14,15-dioxadispiro[5.1.58.26]pentadecane |
| SMILES | c1ccc(C2CCC3(CC2)CC2(CCCCC2)OO3)cc1 |
| InChI | InChI=1S/C19H26O2/c1-3-7-16(8-4-1)17-9-13-19(14-10-17)15-18(20-21-19)11-5-2-6-12-18/h1,3-4,7-8,17H,2,5-6,9-15H2 |
| InChIKey | DELGMIZANSADFG-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 11-phenyl-14,15-dioxadispiro[5.1.58.26]pentadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-phenyl-14,15-dioxadispiro[5.1.58.26]pentadecane?
The IUPAC name of 11-phenyl-14,15-dioxadispiro[5.1.58.26]pentadecane (CID 23656723) is 11-phenyl-14,15-dioxadispiro[5.1.58.26]pentadecane.
What is the SMILES notation for 11-phenyl-14,15-dioxadispiro[5.1.58.26]pentadecane?
The canonical SMILES for 11-phenyl-14,15-dioxadispiro[5.1.58.26]pentadecane is c1ccc(C2CCC3(CC2)CC2(CCCCC2)OO3)cc1.
What is the InChIKey of 11-phenyl-14,15-dioxadispiro[5.1.58.26]pentadecane?
The InChIKey is DELGMIZANSADFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26O2/c1-3-7-16(8-4-1)17-9-13-19(14-10-17)15-18(20-21-19)11-5-2-6-12-18/h1,3-4,7-8,17H,2,5-6,9-15H2.
What are the key properties of 11-phenyl-14,15-dioxadispiro[5.1.58.26]pentadecane?
11-phenyl-14,15-dioxadispiro[5.1.58.26]pentadecane has a molecular weight of 286.41 g/mol, XLogP of 5.14, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 11-phenyl-14,15-dioxadispiro[5.1.58.26]pentadecane is sourced from PubChem (CID 23656723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).