C36H38F3N5O5 — CID 23656783
N-[(1R)-2-(1H-indol-3-yl)-1-[4-[(4-methoxyphenyl)methyl]-5-(2-phenylethyl)-1,2,4-triazol-3-yl]ethyl]oxane-4-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 23656783) has the molecular formula C36H38F3N5O5 and a molecular weight of 677.72 g/mol. Its IUPAC name is N-[(1R)-2-(1H-indol-3-yl)-1-[4-[(4-methoxyphenyl)methyl]-5-(2-phenylethyl)-1,2,4-triazol-3-yl]ethyl]oxane-4-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[(1R)-2-(1H-indol-3-yl)-1-[4-[(4-methoxyphenyl)methyl]-5-(2-phenylethyl)-1,2,4-triazol-3-yl]ethyl]oxane-4-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 23656783 |
| Molecular Formula | C36H38F3N5O5 |
| Molecular Weight | 677.72 g/mol |
| Exact Mass | 677.28 |
| IUPAC Name | N-[(1R)-2-(1H-indol-3-yl)-1-[4-[(4-methoxyphenyl)methyl]-5-(2-phenylethyl)-1,2,4-triazol-3-yl]ethyl]oxane-4-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc(Cn2c(CCc3ccccc3)nnc2[C@@H](Cc2c[nH]c3ccccc23)NC(=O)C2CCOCC2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C34H37N5O3.C2HF3O2/c1-41-28-14-11-25(12-15-28)23-39-32(16-13-24-7-3-2-4-8-24)37-38-33(39)31(36-34(40)26-17-19-42-20-18-26)21-27-22-35-30-10-6-5-9-29(27)30;3-2(4,5)1(6)7/h2-12,14-15,22,26,31,35H,13,16-21,23H2,1H3,(H,36,40);(H,6,7)/t31-;/m1./s1 |
| InChIKey | TYJQNAVZIXRGNV-JSSVAETHSA-N |
| XLogP | 6.06 |
| TPSA | 131.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.72 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |